C20H40N4O5 — CID 170609823
6-amino-N-[2-oxo-2-(propan-2-ylamino)ethyl]hexanamide;N-ethyl-2-(3-methyl-2-oxobutoxy)acetamide (PubChem CID 170609823) has the molecular formula C20H40N4O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is 6-amino-N-[2-oxo-2-(propan-2-ylamino)ethyl]hexanamide;N-ethyl-2-(3-methyl-2-oxobutoxy)acetamide.
| Compound Name | 6-amino-N-[2-oxo-2-(propan-2-ylamino)ethyl]hexanamide;N-ethyl-2-(3-methyl-2-oxobutoxy)acetamide |
|---|---|
| PubChem CID | 170609823 |
| Molecular Formula | C20H40N4O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.30 |
| IUPAC Name | 6-amino-N-[2-oxo-2-(propan-2-ylamino)ethyl]hexanamide;N-ethyl-2-(3-methyl-2-oxobutoxy)acetamide |
| SMILES | CC(C)NC(=O)CNC(=O)CCCCCN.CCNC(=O)COCC(=O)C(C)C |
| InChI | InChI=1S/C11H23N3O2.C9H17NO3/c1-9(2)14-11(16)8-13-10(15)6-4-3-5-7-12;1-4-10-9(12)6-13-5-8(11)7(2)3/h9H,3-8,12H2,1-2H3,(H,13,15)(H,14,16);7H,4-6H2,1-3H3,(H,10,12) |
| InChIKey | BQXNCUKVWNBRRB-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|