C17H18Cl2N7O2+ — CID 170609913
2-[1-[(E)-1-amino-2-[amino(2-hydroxyethyl)amino]ethenyl]-6,7-dichloro-3-(1H-pyrazol-2-ium-4-yl)indol-4-yl]oxyacetonitrile (PubChem CID 170609913) has the molecular formula C17H18Cl2N7O2+ and a molecular weight of 423.28 g/mol. Its IUPAC name is 2-[1-[(E)-1-amino-2-[amino(2-hydroxyethyl)amino]ethenyl]-6,7-dichloro-3-(1H-pyrazol-2-ium-4-yl)indol-4-yl]oxyacetonitrile.
| Compound Name | 2-[1-[(E)-1-amino-2-[amino(2-hydroxyethyl)amino]ethenyl]-6,7-dichloro-3-(1H-pyrazol-2-ium-4-yl)indol-4-yl]oxyacetonitrile |
|---|---|
| PubChem CID | 170609913 |
| Molecular Formula | C17H18Cl2N7O2+ |
| Molecular Weight | 423.28 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | 2-[1-[(E)-1-amino-2-[amino(2-hydroxyethyl)amino]ethenyl]-6,7-dichloro-3-(1H-pyrazol-2-ium-4-yl)indol-4-yl]oxyacetonitrile |
| SMILES | N#CCOc1cc(Cl)c(Cl)c2c1c(-c1c[nH][nH+]c1)cn2/C(N)=C/N(N)CCO |
| InChI | InChI=1S/C17H17Cl2N7O2/c18-12-5-13(28-4-1-20)15-11(10-6-23-24-7-10)8-26(17(15)16(12)19)14(21)9-25(22)2-3-27/h5-9,27H,2-4,21-22H2,(H,23,24)/p+1/b14-9+ |
| InChIKey | HMBBWMFUFPTKRH-NTEUORMPSA-O |
| XLogP | 1.54 |
| TPSA | 143.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|