C27H42ClN6O3Si — CID 170610042
CID 170610042 (PubChem CID 170610042) has the molecular formula C27H42ClN6O3Si and a molecular weight of 562.21 g/mol.
| Compound Name | CID 170610042 |
|---|---|
| PubChem CID | 170610042 |
| Molecular Formula | C27H42ClN6O3Si |
| Molecular Weight | 562.21 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | — |
| SMILES | COc1cc(Cl)cc2c1c(-c1c[nH][n+](C3CCCCO3)c1)cn2/C(N)=C/N(N)CCO[Si-](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H41ClN6O3Si/c1-27(2,3)38(5,6)37-12-10-32(30)18-24(29)33-17-21(26-22(33)13-20(28)14-23(26)35-4)19-15-31-34(16-19)25-9-7-8-11-36-25/h13-18,25H,7-12,29-30H2,1-6H3/q-1/p+1/b24-18+ |
| InChIKey | VYVNRXDKHGTVFM-HKOYGPOVSA-O |
| XLogP | 5.20 |
| TPSA | 107.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.21 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|