C26H32N6 — CID 170610396
N-[1-[4-(2-amino-1-ethanimidoyl-7,8,9,10-tetrahydrobenzo[c][1,8]naphthyridin-6-yl)phenyl]ethenyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 170610396) has the molecular formula C26H32N6 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-[1-[4-(2-amino-1-ethanimidoyl-7,8,9,10-tetrahydrobenzo[c][1,8]naphthyridin-6-yl)phenyl]ethenyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[1-[4-(2-amino-1-ethanimidoyl-7,8,9,10-tetrahydrobenzo[c][1,8]naphthyridin-6-yl)phenyl]ethenyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 170610396 |
| Molecular Formula | C26H32N6 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | N-[1-[4-(2-amino-1-ethanimidoyl-7,8,9,10-tetrahydrobenzo[c][1,8]naphthyridin-6-yl)phenyl]ethenyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | [H]/N=C(\C)c1c(N)cnc2nc(-c3ccc(C(=C)NCCN(C)C)cc3)c3c(c12)CCCC3 |
| InChI | InChI=1S/C26H32N6/c1-16(27)23-22(28)15-30-26-24(23)20-7-5-6-8-21(20)25(31-26)19-11-9-18(10-12-19)17(2)29-13-14-32(3)4/h9-12,15,27,29H,2,5-8,13-14,28H2,1,3-4H3/b27-16+ |
| InChIKey | VUKLNZBRYMYQKC-JVWAILMASA-N |
| XLogP | 4.27 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|