C27H36N6O3 — CID 170611413
tert-butyl 6-amino-12-methyl-8-methylimino-13-oxo-12,15,18,23-tetrazatetracyclo[17.3.1.114,17.02,7]tetracosa-1(23),2(7),3,5,19,21-hexaene-15-carboxylate (PubChem CID 170611413) has the molecular formula C27H36N6O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is tert-butyl 6-amino-12-methyl-8-methylimino-13-oxo-12,15,18,23-tetrazatetracyclo[17.3.1.114,17.02,7]tetracosa-1(23),2(7),3,5,19,21-hexaene-15-carboxylate.
| Compound Name | tert-butyl 6-amino-12-methyl-8-methylimino-13-oxo-12,15,18,23-tetrazatetracyclo[17.3.1.114,17.02,7]tetracosa-1(23),2(7),3,5,19,21-hexaene-15-carboxylate |
|---|---|
| PubChem CID | 170611413 |
| Molecular Formula | C27H36N6O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | tert-butyl 6-amino-12-methyl-8-methylimino-13-oxo-12,15,18,23-tetrazatetracyclo[17.3.1.114,17.02,7]tetracosa-1(23),2(7),3,5,19,21-hexaene-15-carboxylate |
| SMILES | C/N=C1\CCCN(C)C(=O)C2CC(CN2C(=O)OC(C)(C)C)Nc2cccc(n2)-c2cccc(N)c21 |
| InChI | InChI=1S/C27H36N6O3/c1-27(2,3)36-26(35)33-16-17-15-22(33)25(34)32(5)14-8-12-21(29-4)24-18(9-6-10-19(24)28)20-11-7-13-23(30-17)31-20/h6-7,9-11,13,17,22H,8,12,14-16,28H2,1-5H3,(H,30,31)/b29-21+ |
| InChIKey | FNDIXSRVTWOKID-XHLNEMQHSA-N |
| XLogP | 3.79 |
| TPSA | 113.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|