C31H44N6O5 — CID 176681029
ditert-butyl 6-amino-8,12-dimethyl-13-oxo-8,12,15,18,23-pentazatetracyclo[17.3.1.114,17.02,7]tetracosa-1(23),2(7),3,5,19,21-hexaene-15,18-dicarboxylate (PubChem CID 176681029) has the molecular formula C31H44N6O5 and a molecular weight of 580.73 g/mol. Its IUPAC name is ditert-butyl 6-amino-8,12-dimethyl-13-oxo-8,12,15,18,23-pentazatetracyclo[17.3.1.114,17.02,7]tetracosa-1(23),2(7),3,5,19,21-hexaene-15,18-dicarboxylate.
| Compound Name | ditert-butyl 6-amino-8,12-dimethyl-13-oxo-8,12,15,18,23-pentazatetracyclo[17.3.1.114,17.02,7]tetracosa-1(23),2(7),3,5,19,21-hexaene-15,18-dicarboxylate |
|---|---|
| PubChem CID | 176681029 |
| Molecular Formula | C31H44N6O5 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | ditert-butyl 6-amino-8,12-dimethyl-13-oxo-8,12,15,18,23-pentazatetracyclo[17.3.1.114,17.02,7]tetracosa-1(23),2(7),3,5,19,21-hexaene-15,18-dicarboxylate |
| SMILES | CN1CCCN(C)c2c(N)cccc2-c2cccc(n2)N(C(=O)OC(C)(C)C)C2CC(C1=O)N(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C31H44N6O5/c1-30(2,3)41-28(39)36-19-20-18-24(36)27(38)35(8)17-11-16-34(7)26-21(12-9-13-22(26)32)23-14-10-15-25(33-23)37(20)29(40)42-31(4,5)6/h9-10,12-15,20,24H,11,16-19,32H2,1-8H3 |
| InChIKey | IUQIZPNEXQIFDD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|