C28H36N4O4 — CID 176681155
tert-butyl 6-amino-14-methyl-15-oxo-20-oxa-9,14,17-triazatetracyclo[19.3.1.116,19.02,7]hexacosa-1(25),2(7),3,5,8,21,23-heptaene-17-carboxylate (PubChem CID 176681155) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is tert-butyl 6-amino-14-methyl-15-oxo-20-oxa-9,14,17-triazatetracyclo[19.3.1.116,19.02,7]hexacosa-1(25),2(7),3,5,8,21,23-heptaene-17-carboxylate.
| Compound Name | tert-butyl 6-amino-14-methyl-15-oxo-20-oxa-9,14,17-triazatetracyclo[19.3.1.116,19.02,7]hexacosa-1(25),2(7),3,5,8,21,23-heptaene-17-carboxylate |
|---|---|
| PubChem CID | 176681155 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | tert-butyl 6-amino-14-methyl-15-oxo-20-oxa-9,14,17-triazatetracyclo[19.3.1.116,19.02,7]hexacosa-1(25),2(7),3,5,8,21,23-heptaene-17-carboxylate |
| SMILES | CN1CCCC/N=C/c2c(N)cccc2-c2cccc(c2)OC2CC(C1=O)N(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C28H36N4O4/c1-28(2,3)36-27(34)32-18-21-16-25(32)26(33)31(4)14-6-5-13-30-17-23-22(11-8-12-24(23)29)19-9-7-10-20(15-19)35-21/h7-12,15,17,21,25H,5-6,13-14,16,18,29H2,1-4H3/b30-17+ |
| InChIKey | JFWCSPQVJSQFQJ-OCSSWDANSA-N |
| XLogP | 4.36 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|