C24H27F4N7OS — CID 170611799
2-[6-[[[amino-[(Z)-2-amino-2-(6-amino-3-pyridinyl)ethenyl]amino]methylsulfanyl-methylamino]-difluoromethyl]-3-fluoro-2-(4-fluorophenyl)-4-pyridinyl]propan-2-ol (PubChem CID 170611799) has the molecular formula C24H27F4N7OS and a molecular weight of 537.59 g/mol. Its IUPAC name is 2-[6-[[[amino-[(Z)-2-amino-2-(6-amino-3-pyridinyl)ethenyl]amino]methylsulfanyl-methylamino]-difluoromethyl]-3-fluoro-2-(4-fluorophenyl)-4-pyridinyl]propan-2-ol.
| Compound Name | 2-[6-[[[amino-[(Z)-2-amino-2-(6-amino-3-pyridinyl)ethenyl]amino]methylsulfanyl-methylamino]-difluoromethyl]-3-fluoro-2-(4-fluorophenyl)-4-pyridinyl]propan-2-ol |
|---|---|
| PubChem CID | 170611799 |
| Molecular Formula | C24H27F4N7OS |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | 2-[6-[[[amino-[(Z)-2-amino-2-(6-amino-3-pyridinyl)ethenyl]amino]methylsulfanyl-methylamino]-difluoromethyl]-3-fluoro-2-(4-fluorophenyl)-4-pyridinyl]propan-2-ol |
| SMILES | CN(SCN(N)/C=C(\N)c1ccc(N)nc1)C(F)(F)c1cc(C(C)(C)O)c(F)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C24H27F4N7OS/c1-23(2,36)17-10-19(33-22(21(17)26)14-4-7-16(25)8-5-14)24(27,28)34(3)37-13-35(31)12-18(29)15-6-9-20(30)32-11-15/h4-12,36H,13,29,31H2,1-3H3,(H2,30,32)/b18-12- |
| InChIKey | XETSPCYLEBUVFC-PDGQHHTCSA-N |
| XLogP | 3.95 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|