C13H20ClN5O — CID 170612506
(1E,3E)-1-chloro-4-[3-[3-(methylamino)-1H-pyrazol-5-yl]cyclopentyl]oxybuta-1,3-diene-1,4-diamine (PubChem CID 170612506) has the molecular formula C13H20ClN5O and a molecular weight of 297.79 g/mol. Its IUPAC name is (1E,3E)-1-chloro-4-[3-[3-(methylamino)-1H-pyrazol-5-yl]cyclopentyl]oxybuta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3E)-1-chloro-4-[3-[3-(methylamino)-1H-pyrazol-5-yl]cyclopentyl]oxybuta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 170612506 |
| Molecular Formula | C13H20ClN5O |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (1E,3E)-1-chloro-4-[3-[3-(methylamino)-1H-pyrazol-5-yl]cyclopentyl]oxybuta-1,3-diene-1,4-diamine |
| SMILES | CNc1cc(C2CCC(O/C(N)=C/C=C(\N)Cl)C2)[nH]n1 |
| InChI | InChI=1S/C13H20ClN5O/c1-17-13-7-10(18-19-13)8-2-3-9(6-8)20-12(16)5-4-11(14)15/h4-5,7-9H,2-3,6,15-16H2,1H3,(H2,17,18,19)/b11-4-,12-5+ |
| InChIKey | VUIBZGDVIHRYQB-NKXDNZRASA-N |
| XLogP | 1.94 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|