C21H27FN7O2+ — CID 176949696
N-[5-[3-[(E)-1-amino-2-methanimidoyl-3-methylbut-1-enoxy]cyclopentyl]-1H-pyrazol-3-yl]-4-fluoro-1-oxo-2,3-dihydroindazol-1-ium-5-amine (PubChem CID 176949696) has the molecular formula C21H27FN7O2+ and a molecular weight of 428.49 g/mol. Its IUPAC name is N-[5-[3-[(E)-1-amino-2-methanimidoyl-3-methylbut-1-enoxy]cyclopentyl]-1H-pyrazol-3-yl]-4-fluoro-1-oxo-2,3-dihydroindazol-1-ium-5-amine.
| Compound Name | N-[5-[3-[(E)-1-amino-2-methanimidoyl-3-methylbut-1-enoxy]cyclopentyl]-1H-pyrazol-3-yl]-4-fluoro-1-oxo-2,3-dihydroindazol-1-ium-5-amine |
|---|---|
| PubChem CID | 176949696 |
| Molecular Formula | C21H27FN7O2+ |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N-[5-[3-[(E)-1-amino-2-methanimidoyl-3-methylbut-1-enoxy]cyclopentyl]-1H-pyrazol-3-yl]-4-fluoro-1-oxo-2,3-dihydroindazol-1-ium-5-amine |
| SMILES | [H]/N=C/C(=C(\N)OC1CCC(c2cc(Nc3ccc4c(c3F)CN[N+]4=O)n[nH]2)C1)C(C)C |
| InChI | InChI=1S/C21H27FN7O2/c1-11(2)14(9-23)21(24)31-13-4-3-12(7-13)17-8-19(28-27-17)26-16-5-6-18-15(20(16)22)10-25-29(18)30/h5-6,8-9,11-13,23H,3-4,7,10,24H2,1-2H3,(H,25,30)(H2,26,27,28)/q+1/b21-14-,23-9+ |
| InChIKey | IDEQEAODLQVBHU-YIXKRVHUSA-N |
| XLogP | 3.85 |
| TPSA | 131.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|