C24H34FN5OS — CID 176949673
[3-[3-(3-ethyl-2-fluoro-4-methylsulfanylanilino)-1H-pyrazol-5-yl]cyclopentyl] (NZ,1E)-N-ethylidene-2-methylbutanehydrazonate (PubChem CID 176949673) has the molecular formula C24H34FN5OS and a molecular weight of 459.64 g/mol. Its IUPAC name is [3-[3-(3-ethyl-2-fluoro-4-methylsulfanylanilino)-1H-pyrazol-5-yl]cyclopentyl] (NZ,1E)-N-ethylidene-2-methylbutanehydrazonate.
| Compound Name | [3-[3-(3-ethyl-2-fluoro-4-methylsulfanylanilino)-1H-pyrazol-5-yl]cyclopentyl] (NZ,1E)-N-ethylidene-2-methylbutanehydrazonate |
|---|---|
| PubChem CID | 176949673 |
| Molecular Formula | C24H34FN5OS |
| Molecular Weight | 459.64 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | [3-[3-(3-ethyl-2-fluoro-4-methylsulfanylanilino)-1H-pyrazol-5-yl]cyclopentyl] (NZ,1E)-N-ethylidene-2-methylbutanehydrazonate |
| SMILES | C/C=N\N=C(\OC1CCC(c2cc(Nc3ccc(SC)c(CC)c3F)n[nH]2)C1)C(C)CC |
| InChI | InChI=1S/C24H34FN5OS/c1-6-15(4)24(30-26-8-3)31-17-10-9-16(13-17)20-14-22(29-28-20)27-19-11-12-21(32-5)18(7-2)23(19)25/h8,11-12,14-17H,6-7,9-10,13H2,1-5H3,(H2,27,28,29)/b26-8-,30-24+ |
| InChIKey | HDONODVTBOMVIC-HOWPCWBWSA-N |
| XLogP | 6.68 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.64 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|