C32H47FN4O — CID 176949695
N-[4-butyl-2-fluoro-3-(methylaminomethyl)phenyl]-5-[3-[(4E,6Z)-2,2-dimethyl-3-methylidenenona-4,6-dien-4-yl]oxycyclopentyl]-1H-pyrazol-3-amine (PubChem CID 176949695) has the molecular formula C32H47FN4O and a molecular weight of 522.75 g/mol. Its IUPAC name is N-[4-butyl-2-fluoro-3-(methylaminomethyl)phenyl]-5-[3-[(4E,6Z)-2,2-dimethyl-3-methylidenenona-4,6-dien-4-yl]oxycyclopentyl]-1H-pyrazol-3-amine.
| Compound Name | N-[4-butyl-2-fluoro-3-(methylaminomethyl)phenyl]-5-[3-[(4E,6Z)-2,2-dimethyl-3-methylidenenona-4,6-dien-4-yl]oxycyclopentyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 176949695 |
| Molecular Formula | C32H47FN4O |
| Molecular Weight | 522.75 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | N-[4-butyl-2-fluoro-3-(methylaminomethyl)phenyl]-5-[3-[(4E,6Z)-2,2-dimethyl-3-methylidenenona-4,6-dien-4-yl]oxycyclopentyl]-1H-pyrazol-3-amine |
| SMILES | C=C(/C(=C\C=C/CC)OC1CCC(c2cc(Nc3ccc(CCCC)c(CNC)c3F)n[nH]2)C1)C(C)(C)C |
| InChI | InChI=1S/C32H47FN4O/c1-8-10-12-14-29(22(3)32(4,5)6)38-25-17-15-24(19-25)28-20-30(37-36-28)35-27-18-16-23(13-11-9-2)26(21-34-7)31(27)33/h10,12,14,16,18,20,24-25,34H,3,8-9,11,13,15,17,19,21H2,1-2,4-7H3,(H2,35,36,37)/b12-10-,29-14+ |
| InChIKey | GJKKZGXLXMJAJQ-ICPIZKTASA-N |
| XLogP | 8.46 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.75 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|