C27H40FN4OSb — CID 176949644
N-[5-[3-[(E)-3-tert-butyl-4-methylhex-2-enoxy]cyclopentyl]-1H-pyrazol-3-yl]-4-fluoro-1-methyl-2,3-dihydro-2,1-benzazastibol-5-amine (PubChem CID 176949644) has the molecular formula C27H40FN4OSb and a molecular weight of 577.40 g/mol. Its IUPAC name is N-[5-[3-[(E)-3-tert-butyl-4-methylhex-2-enoxy]cyclopentyl]-1H-pyrazol-3-yl]-4-fluoro-1-methyl-2,3-dihydro-2,1-benzazastibol-5-amine.
| Compound Name | N-[5-[3-[(E)-3-tert-butyl-4-methylhex-2-enoxy]cyclopentyl]-1H-pyrazol-3-yl]-4-fluoro-1-methyl-2,3-dihydro-2,1-benzazastibol-5-amine |
|---|---|
| PubChem CID | 176949644 |
| Molecular Formula | C27H40FN4OSb |
| Molecular Weight | 577.40 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | N-[5-[3-[(E)-3-tert-butyl-4-methylhex-2-enoxy]cyclopentyl]-1H-pyrazol-3-yl]-4-fluoro-1-methyl-2,3-dihydro-2,1-benzazastibol-5-amine |
| SMILES | CCC(C)/C(=C\COC1CCC(c2cc(Nc3ccc4c(c3F)CN[Sb]4C)n[nH]2)C1)C(C)(C)C |
| InChI | InChI=1S/C26H37FN4O.CH3.Sb/c1-6-17(2)21(26(3,4)5)12-13-32-20-11-10-18(14-20)23-15-24(31-30-23)29-22-9-7-8-19(16-28)25(22)27;;/h7,9,12,15,17-18,20,28H,6,10-11,13-14,16H2,1-5H3,(H2,29,30,31);1H3;/q-1;;+1/b21-12+;; |
| InChIKey | NMORSLLNDZZIMS-VNFMCAGGSA-N |
| XLogP | 5.90 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.40 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|