C23H33CsFN6OSb — CID 176949706
cesium;N-[5-[3-[(E)-1-amino-2-methanimidoyl-3-methylbut-1-enoxy]cyclopentyl]-1H-pyrazol-3-yl]-4-fluoro-1-methyl-2,3-dihydro-2,1-benzazastibol-5-amine;carbanide (PubChem CID 176949706) has the molecular formula C23H33CsFN6OSb and a molecular weight of 683.22 g/mol. Its IUPAC name is cesium;N-[5-[3-[(E)-1-amino-2-methanimidoyl-3-methylbut-1-enoxy]cyclopentyl]-1H-pyrazol-3-yl]-4-fluoro-1-methyl-2,3-dihydro-2,1-benzazastibol-5-amine;carbanide.
| Compound Name | cesium;N-[5-[3-[(E)-1-amino-2-methanimidoyl-3-methylbut-1-enoxy]cyclopentyl]-1H-pyrazol-3-yl]-4-fluoro-1-methyl-2,3-dihydro-2,1-benzazastibol-5-amine;carbanide |
|---|---|
| PubChem CID | 176949706 |
| Molecular Formula | C23H33CsFN6OSb |
| Molecular Weight | 683.22 g/mol |
| Exact Mass | 682.08 |
| IUPAC Name | cesium;N-[5-[3-[(E)-1-amino-2-methanimidoyl-3-methylbut-1-enoxy]cyclopentyl]-1H-pyrazol-3-yl]-4-fluoro-1-methyl-2,3-dihydro-2,1-benzazastibol-5-amine;carbanide |
| SMILES | [CH3-].[Cs+].[H]/N=C/C(=C(\N)OC1CCC(c2cc(Nc3ccc4c(c3F)CN[Sb]4C)n[nH]2)C1)C(C)C |
| InChI | InChI=1S/C21H27FN6O.2CH3.Cs.Sb/c1-12(2)16(11-24)21(25)29-15-7-6-13(8-15)18-9-19(28-27-18)26-17-5-3-4-14(10-23)20(17)22;;;;/h3,5,9,11-13,15,23-24H,6-8,10,25H2,1-2H3,(H2,26,27,28);2*1H3;;/q-1;;-1;2*+1/b21-16-,24-11+;;;; |
| InChIKey | PJOHJSYEYWUVDF-NQHHTVLYSA-N |
| XLogP | 0.81 |
| TPSA | 111.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|