C24H32FN4O2Sb — CID 176949480
(Z)-2-[(E)-1-[3-[3-[(4-fluoro-1-methyl-2,3-dihydro-2,1-benzazastibol-5-yl)amino]-1H-pyrazol-5-yl]cyclopentyl]but-1-enoxy]but-2-en-1-ol (PubChem CID 176949480) has the molecular formula C24H32FN4O2Sb and a molecular weight of 549.30 g/mol. Its IUPAC name is (Z)-2-[(E)-1-[3-[3-[(4-fluoro-1-methyl-2,3-dihydro-2,1-benzazastibol-5-yl)amino]-1H-pyrazol-5-yl]cyclopentyl]but-1-enoxy]but-2-en-1-ol.
| Compound Name | (Z)-2-[(E)-1-[3-[3-[(4-fluoro-1-methyl-2,3-dihydro-2,1-benzazastibol-5-yl)amino]-1H-pyrazol-5-yl]cyclopentyl]but-1-enoxy]but-2-en-1-ol |
|---|---|
| PubChem CID | 176949480 |
| Molecular Formula | C24H32FN4O2Sb |
| Molecular Weight | 549.30 g/mol |
| Exact Mass | 548.15 |
| IUPAC Name | (Z)-2-[(E)-1-[3-[3-[(4-fluoro-1-methyl-2,3-dihydro-2,1-benzazastibol-5-yl)amino]-1H-pyrazol-5-yl]cyclopentyl]but-1-enoxy]but-2-en-1-ol |
| SMILES | C/C=C(/CO)O/C(=C/CC)C1CCC(c2cc(Nc3ccc4c(c3F)CN[Sb]4C)n[nH]2)C1 |
| InChI | InChI=1S/C23H29FN4O2.CH3.Sb/c1-3-6-21(30-18(4-2)14-29)16-10-9-15(11-16)20-12-22(28-27-20)26-19-8-5-7-17(13-25)23(19)24;;/h4-6,8,12,15-16,25,29H,3,9-11,13-14H2,1-2H3,(H2,26,27,28);1H3;/q-1;;+1/b18-4-,21-6+;; |
| InChIKey | DTPRZYDSQUMAHK-BPIRKKAWSA-N |
| XLogP | 4.31 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|