C24H28FN5Sb — CID 176949406
CID 176949406 (PubChem CID 176949406) has the molecular formula C24H28FN5Sb and a molecular weight of 527.28 g/mol.
| Compound Name | CID 176949406 |
|---|---|
| PubChem CID | 176949406 |
| Molecular Formula | C24H28FN5Sb |
| Molecular Weight | 527.28 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cccc(C2CCC(c3cc(Nc4ccc5c(c4F)CN[Sb]5)n[nH]3)C2)n1 |
| InChI | InChI=1S/C24H28FN5.Sb/c1-24(2,3)21-9-5-7-18(27-21)15-10-11-16(12-15)20-13-22(30-29-20)28-19-8-4-6-17(14-26)23(19)25;/h4-5,7-9,13,15-16,26H,10-12,14H2,1-3H3,(H2,28,29,30);/q-1;+1 |
| InChIKey | XTLROFSRKXYVFB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|