C26H36FN5Sb — CID 176949612
CID 176949612 (PubChem CID 176949612) has the molecular formula C26H36FN5Sb and a molecular weight of 559.37 g/mol.
| Compound Name | CID 176949612 |
|---|---|
| PubChem CID | 176949612 |
| Molecular Formula | C26H36FN5Sb |
| Molecular Weight | 559.37 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | — |
| SMILES | C/C=C\C(=N\C(CCC)C1CCC(c2cc(Nc3ccc4c(c3F)CN[Sb]4)n[nH]2)C1)C(C)C |
| InChI | InChI=1S/C26H36FN5.Sb/c1-5-8-21(17(3)4)29-22(9-6-2)18-12-13-19(14-18)24-15-25(32-31-24)30-23-11-7-10-20(16-28)26(23)27;/h5,7-8,11,15,17-19,22,28H,6,9,12-14,16H2,1-4H3,(H2,30,31,32);/q-1;+1/b8-5-,29-21-; |
| InChIKey | NTWRVZGQJINELX-ZZNMXAEGSA-N |
| XLogP | 5.37 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.37 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|