C21H27FN6OS — CID 176949455
N-[5-[3-[(E)-1-amino-2-methanimidoyl-3-methylbut-1-enoxy]cyclopentyl]-1H-pyrazol-3-yl]-4-fluoro-2,3-dihydro-1,2-benzothiazol-5-amine (PubChem CID 176949455) has the molecular formula C21H27FN6OS and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[5-[3-[(E)-1-amino-2-methanimidoyl-3-methylbut-1-enoxy]cyclopentyl]-1H-pyrazol-3-yl]-4-fluoro-2,3-dihydro-1,2-benzothiazol-5-amine.
| Compound Name | N-[5-[3-[(E)-1-amino-2-methanimidoyl-3-methylbut-1-enoxy]cyclopentyl]-1H-pyrazol-3-yl]-4-fluoro-2,3-dihydro-1,2-benzothiazol-5-amine |
|---|---|
| PubChem CID | 176949455 |
| Molecular Formula | C21H27FN6OS |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | N-[5-[3-[(E)-1-amino-2-methanimidoyl-3-methylbut-1-enoxy]cyclopentyl]-1H-pyrazol-3-yl]-4-fluoro-2,3-dihydro-1,2-benzothiazol-5-amine |
| SMILES | [H]/N=C/C(=C(\N)OC1CCC(c2cc(Nc3ccc4c(c3F)CNS4)n[nH]2)C1)C(C)C |
| InChI | InChI=1S/C21H27FN6OS/c1-11(2)14(9-23)21(24)29-13-4-3-12(7-13)17-8-19(28-27-17)26-16-5-6-18-15(20(16)22)10-25-30-18/h5-6,8-9,11-13,23,25H,3-4,7,10,24H2,1-2H3,(H2,26,27,28)/b21-14-,23-9+ |
| InChIKey | PXZNNKPHKYPICF-YIXKRVHUSA-N |
| XLogP | 4.53 |
| TPSA | 111.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|