C23H31FN6O — CID 176949501
[3-[3-[3-(aminomethyl)-2-fluoroanilino]-1H-pyrazol-5-yl]cyclopentyl] (Z,1E)-N-methylidene-2-propan-2-ylbut-2-enehydrazonate (PubChem CID 176949501) has the molecular formula C23H31FN6O and a molecular weight of 426.54 g/mol. Its IUPAC name is [3-[3-[3-(aminomethyl)-2-fluoroanilino]-1H-pyrazol-5-yl]cyclopentyl] (Z,1E)-N-methylidene-2-propan-2-ylbut-2-enehydrazonate.
| Compound Name | [3-[3-[3-(aminomethyl)-2-fluoroanilino]-1H-pyrazol-5-yl]cyclopentyl] (Z,1E)-N-methylidene-2-propan-2-ylbut-2-enehydrazonate |
|---|---|
| PubChem CID | 176949501 |
| Molecular Formula | C23H31FN6O |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | [3-[3-[3-(aminomethyl)-2-fluoroanilino]-1H-pyrazol-5-yl]cyclopentyl] (Z,1E)-N-methylidene-2-propan-2-ylbut-2-enehydrazonate |
| SMILES | C=N/N=C(OC1CCC(c2cc(Nc3cccc(CN)c3F)n[nH]2)C1)\C(=C/C)C(C)C |
| InChI | InChI=1S/C23H31FN6O/c1-5-18(14(2)3)23(30-26-4)31-17-10-9-15(11-17)20-12-21(29-28-20)27-19-8-6-7-16(13-25)22(19)24/h5-8,12,14-15,17H,4,9-11,13,25H2,1-3H3,(H2,27,28,29)/b18-5-,30-23+ |
| InChIKey | KSPNWDWZQTVWPK-JNIMZDNGSA-N |
| XLogP | 5.02 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|