C13H27F3N2 — CID 170614169
ethane;2-methyl-5-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 170614169) has the molecular formula C13H27F3N2 and a molecular weight of 268.37 g/mol. Its IUPAC name is ethane;2-methyl-5-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | ethane;2-methyl-5-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 170614169 |
| Molecular Formula | C13H27F3N2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.21 |
| IUPAC Name | ethane;2-methyl-5-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CC.CC.CN1CC2CN(CC(F)(F)F)CC2C1 |
| InChI | InChI=1S/C9H15F3N2.2C2H6/c1-13-2-7-4-14(5-8(7)3-13)6-9(10,11)12;2*1-2/h7-8H,2-6H2,1H3;2*1-2H3 |
| InChIKey | BEMNPECCSNRBII-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |