C8H12F3IN2 — CID 144963108
(3aR,6aS)-5-iodo-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 144963108) has the molecular formula C8H12F3IN2 and a molecular weight of 320.10 g/mol. Its IUPAC name is (3aR,6aS)-5-iodo-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aS)-5-iodo-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 144963108 |
| Molecular Formula | C8H12F3IN2 |
| Molecular Weight | 320.10 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | (3aR,6aS)-5-iodo-2-(2,2,2-trifluoroethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | FC(F)(F)CN1C[C@H]2CN(I)C[C@H]2C1 |
| InChI | InChI=1S/C8H12F3IN2/c9-8(10,11)5-13-1-6-3-14(12)4-7(6)2-13/h6-7H,1-5H2/t6-,7+ |
| InChIKey | ARHUMLVOLJYXHV-KNVOCYPGSA-N |
| XLogP | 1.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.10 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|