C29H44N4O5 — CID 170614792
tert-butyl 4-[1-(1,2,3,4-tetrahydroquinolin-5-yl)piperidin-4-yl]oxypiperidine-1-carboxylate;piperidine-2,6-dione (PubChem CID 170614792) has the molecular formula C29H44N4O5 and a molecular weight of 528.69 g/mol. Its IUPAC name is tert-butyl 4-[1-(1,2,3,4-tetrahydroquinolin-5-yl)piperidin-4-yl]oxypiperidine-1-carboxylate;piperidine-2,6-dione.
| Compound Name | tert-butyl 4-[1-(1,2,3,4-tetrahydroquinolin-5-yl)piperidin-4-yl]oxypiperidine-1-carboxylate;piperidine-2,6-dione |
|---|---|
| PubChem CID | 170614792 |
| Molecular Formula | C29H44N4O5 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | tert-butyl 4-[1-(1,2,3,4-tetrahydroquinolin-5-yl)piperidin-4-yl]oxypiperidine-1-carboxylate;piperidine-2,6-dione |
| SMILES | CC(C)(C)OC(=O)N1CCC(OC2CCN(c3cccc4c3CCCN4)CC2)CC1.O=C1CCCC(=O)N1 |
| InChI | InChI=1S/C24H37N3O3.C5H7NO2/c1-24(2,3)30-23(28)27-16-11-19(12-17-27)29-18-9-14-26(15-10-18)22-8-4-7-21-20(22)6-5-13-25-21;7-4-2-1-3-5(8)6-4/h4,7-8,18-19,25H,5-6,9-17H2,1-3H3;1-3H2,(H,6,7,8) |
| InChIKey | NYGAXHURWAEVKY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|