C13H12N6O2 — CID 170616018
N-[[1-(2-amino-2-oxoethyl)triazol-4-yl]methyl]-3-cyanobenzamide (PubChem CID 170616018) has the molecular formula C13H12N6O2 and a molecular weight of 284.28 g/mol. Its IUPAC name is N-[[1-(2-amino-2-oxoethyl)triazol-4-yl]methyl]-3-cyanobenzamide.
| Compound Name | N-[[1-(2-amino-2-oxoethyl)triazol-4-yl]methyl]-3-cyanobenzamide |
|---|---|
| PubChem CID | 170616018 |
| Molecular Formula | C13H12N6O2 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-[[1-(2-amino-2-oxoethyl)triazol-4-yl]methyl]-3-cyanobenzamide |
| SMILES | N#Cc1cccc(C(=O)NCc2cn(CC(N)=O)nn2)c1 |
| InChI | InChI=1S/C13H12N6O2/c14-5-9-2-1-3-10(4-9)13(21)16-6-11-7-19(18-17-11)8-12(15)20/h1-4,7H,6,8H2,(H2,15,20)(H,16,21) |
| InChIKey | WTNJLJTZDJRNCN-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |