C33H50N4O8 — CID 170620914
1-[(E)-2-cyano-4,4-dimethylpent-2-enoyl]-N-[2-[2-[2-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-5-phenylpiperidine-3-carboxamide (PubChem CID 170620914) has the molecular formula C33H50N4O8 and a molecular weight of 630.78 g/mol. Its IUPAC name is 1-[(E)-2-cyano-4,4-dimethylpent-2-enoyl]-N-[2-[2-[2-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-5-phenylpiperidine-3-carboxamide.
| Compound Name | 1-[(E)-2-cyano-4,4-dimethylpent-2-enoyl]-N-[2-[2-[2-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-5-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 170620914 |
| Molecular Formula | C33H50N4O8 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.36 |
| IUPAC Name | 1-[(E)-2-cyano-4,4-dimethylpent-2-enoyl]-N-[2-[2-[2-[2-[2-(2-formamidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]-5-phenylpiperidine-3-carboxamide |
| SMILES | CC(C)(C)/C=C(\C#N)C(=O)N1CC(C(=O)NCCOCCOCCOCCOCCOCCNC=O)CC(c2ccccc2)C1 |
| InChI | InChI=1S/C33H50N4O8/c1-33(2,3)22-30(23-34)32(40)37-24-28(27-7-5-4-6-8-27)21-29(25-37)31(39)36-10-12-42-14-16-44-18-20-45-19-17-43-15-13-41-11-9-35-26-38/h4-8,22,26,28-29H,9-21,24-25H2,1-3H3,(H,35,38)(H,36,39)/b30-22+ |
| InChIKey | GSPDUBLXFGWFSA-JBASAIQMSA-N |
| XLogP | 2.06 |
| TPSA | 148.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|