C19H21N3OS — CID 170621355
S-[4-[(8-methoxy-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-yl)methyl]phenyl]thiohydroxylamine (PubChem CID 170621355) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is S-[4-[(8-methoxy-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-yl)methyl]phenyl]thiohydroxylamine.
| Compound Name | S-[4-[(8-methoxy-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-yl)methyl]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 170621355 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | S-[4-[(8-methoxy-1,2,3,4-tetrahydropyrido[4,3-b]indol-5-yl)methyl]phenyl]thiohydroxylamine |
| SMILES | COc1ccc2c(c1)c1c(n2Cc2ccc(SN)cc2)CCNC1 |
| InChI | InChI=1S/C19H21N3OS/c1-23-14-4-7-18-16(10-14)17-11-21-9-8-19(17)22(18)12-13-2-5-15(24-20)6-3-13/h2-7,10,21H,8-9,11-12,20H2,1H3 |
| InChIKey | JVMBBEGCKNBNDA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|