C19H17N3OS — CID 174303203
S-[4-[(6-methoxypyrido[3,4-b]indol-9-yl)methyl]phenyl]thiohydroxylamine (PubChem CID 174303203) has the molecular formula C19H17N3OS and a molecular weight of 335.43 g/mol. Its IUPAC name is S-[4-[(6-methoxypyrido[3,4-b]indol-9-yl)methyl]phenyl]thiohydroxylamine.
| Compound Name | S-[4-[(6-methoxypyrido[3,4-b]indol-9-yl)methyl]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 174303203 |
| Molecular Formula | C19H17N3OS |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | S-[4-[(6-methoxypyrido[3,4-b]indol-9-yl)methyl]phenyl]thiohydroxylamine |
| SMILES | COc1ccc2c(c1)c1ccncc1n2Cc1ccc(SN)cc1 |
| InChI | InChI=1S/C19H17N3OS/c1-23-14-4-7-18-17(10-14)16-8-9-21-11-19(16)22(18)12-13-2-5-15(24-20)6-3-13/h2-11H,12,20H2,1H3 |
| InChIKey | XMNFUMMSPWJSPW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|