C19H11F5N2O — CID 90870772
7-methoxy-9-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrido[3,4-b]indole (PubChem CID 90870772) has the molecular formula C19H11F5N2O and a molecular weight of 378.30 g/mol. Its IUPAC name is 7-methoxy-9-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrido[3,4-b]indole.
| Compound Name | 7-methoxy-9-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 90870772 |
| Molecular Formula | C19H11F5N2O |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 7-methoxy-9-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrido[3,4-b]indole |
| SMILES | COc1ccc2c3ccncc3n(Cc3c(F)c(F)c(F)c(F)c3F)c2c1 |
| InChI | InChI=1S/C19H11F5N2O/c1-27-9-2-3-10-11-4-5-25-7-14(11)26(13(10)6-9)8-12-15(20)17(22)19(24)18(23)16(12)21/h2-7H,8H2,1H3 |
| InChIKey | BHMKIUJNDSYFAC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|