C11H15BrN2O2 — CID 170622467
1-bromo-2,3-dimethylbenzene;(2E)-2-hydroxyimino-N-methylacetamide (PubChem CID 170622467) has the molecular formula C11H15BrN2O2 and a molecular weight of 287.16 g/mol. Its IUPAC name is 1-bromo-2,3-dimethylbenzene;(2E)-2-hydroxyimino-N-methylacetamide.
| Compound Name | 1-bromo-2,3-dimethylbenzene;(2E)-2-hydroxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 170622467 |
| Molecular Formula | C11H15BrN2O2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 1-bromo-2,3-dimethylbenzene;(2E)-2-hydroxyimino-N-methylacetamide |
| SMILES | CNC(=O)/C=N/O.Cc1cccc(Br)c1C |
| InChI | InChI=1S/C8H9Br.C3H6N2O2/c1-6-4-3-5-8(9)7(6)2;1-4-3(6)2-5-7/h3-5H,1-2H3;2,7H,1H3,(H,4,6)/b;5-2+ |
| InChIKey | LFONDECJIGKHBN-UPNXXXCKSA-N |
| XLogP | 2.26 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|