C12H20BrN — CID 143866521
1-bromo-2,3-dimethylbenzene;N-ethylethanamine (PubChem CID 143866521) has the molecular formula C12H20BrN and a molecular weight of 258.20 g/mol. Its IUPAC name is 1-bromo-2,3-dimethylbenzene;N-ethylethanamine.
| Compound Name | 1-bromo-2,3-dimethylbenzene;N-ethylethanamine |
|---|---|
| PubChem CID | 143866521 |
| Molecular Formula | C12H20BrN |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 1-bromo-2,3-dimethylbenzene;N-ethylethanamine |
| SMILES | CCNCC.Cc1cccc(Br)c1C |
| InChI | InChI=1S/C8H9Br.C4H11N/c1-6-4-3-5-8(9)7(6)2;1-3-5-4-2/h3-5H,1-2H3;5H,3-4H2,1-2H3 |
| InChIKey | IILBJMVIBXDETF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |