C18H27N3O4S — CID 170623923
3-[3-(3,4-dihydro-2H-thiochromen-6-ylamino)-1H-pyrazol-5-yl]cyclopentan-1-ol;hydrogen peroxide;methanol (PubChem CID 170623923) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is 3-[3-(3,4-dihydro-2H-thiochromen-6-ylamino)-1H-pyrazol-5-yl]cyclopentan-1-ol;hydrogen peroxide;methanol.
| Compound Name | 3-[3-(3,4-dihydro-2H-thiochromen-6-ylamino)-1H-pyrazol-5-yl]cyclopentan-1-ol;hydrogen peroxide;methanol |
|---|---|
| PubChem CID | 170623923 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-[3-(3,4-dihydro-2H-thiochromen-6-ylamino)-1H-pyrazol-5-yl]cyclopentan-1-ol;hydrogen peroxide;methanol |
| SMILES | CO.OC1CCC(c2cc(Nc3ccc4c(c3)CCCS4)n[nH]2)C1.OO |
| InChI | InChI=1S/C17H21N3OS.CH4O.H2O2/c21-14-5-3-11(9-14)15-10-17(20-19-15)18-13-4-6-16-12(8-13)2-1-7-22-16;2*1-2/h4,6,8,10-11,14,21H,1-3,5,7,9H2,(H2,18,19,20);2H,1H3;1-2H |
| InChIKey | ZDAKDHJXEBYBBB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 121.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|