C21H25N5O3S — CID 176949417
2,2-dioxo-N-[5-[(1S,3R)-3-(5-propan-2-yl-1,3-oxazol-2-yl)cyclopentyl]-1H-pyrazol-3-yl]-1,3-dihydro-2,1-benzothiazol-5-amine (PubChem CID 176949417) has the molecular formula C21H25N5O3S and a molecular weight of 427.53 g/mol. Its IUPAC name is 2,2-dioxo-N-[5-[(1S,3R)-3-(5-propan-2-yl-1,3-oxazol-2-yl)cyclopentyl]-1H-pyrazol-3-yl]-1,3-dihydro-2,1-benzothiazol-5-amine.
| Compound Name | 2,2-dioxo-N-[5-[(1S,3R)-3-(5-propan-2-yl-1,3-oxazol-2-yl)cyclopentyl]-1H-pyrazol-3-yl]-1,3-dihydro-2,1-benzothiazol-5-amine |
|---|---|
| PubChem CID | 176949417 |
| Molecular Formula | C21H25N5O3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 2,2-dioxo-N-[5-[(1S,3R)-3-(5-propan-2-yl-1,3-oxazol-2-yl)cyclopentyl]-1H-pyrazol-3-yl]-1,3-dihydro-2,1-benzothiazol-5-amine |
| SMILES | CC(C)c1cnc([C@@H]2CC[C@H](c3cc(Nc4ccc5c(c4)CS(=O)(=O)N5)n[nH]3)C2)o1 |
| InChI | InChI=1S/C21H25N5O3S/c1-12(2)19-10-22-21(29-19)14-4-3-13(7-14)18-9-20(25-24-18)23-16-5-6-17-15(8-16)11-30(27,28)26-17/h5-6,8-10,12-14,26H,3-4,7,11H2,1-2H3,(H2,23,24,25)/t13-,14+/m0/s1 |
| InChIKey | IYTBAKGXTMLSNK-UONOGXRCSA-N |
| XLogP | 4.57 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |