C15H22N2S — CID 115149711
4-N-(3,4-dihydro-2H-thiochromen-6-yl)cyclohexane-1,4-diamine (PubChem CID 115149711) has the molecular formula C15H22N2S and a molecular weight of 262.42 g/mol. Its IUPAC name is 4-N-(3,4-dihydro-2H-thiochromen-6-yl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-(3,4-dihydro-2H-thiochromen-6-yl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 115149711 |
| Molecular Formula | C15H22N2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-N-(3,4-dihydro-2H-thiochromen-6-yl)cyclohexane-1,4-diamine |
| SMILES | NC1CCC(Nc2ccc3c(c2)CCCS3)CC1 |
| InChI | InChI=1S/C15H22N2S/c16-12-3-5-13(6-4-12)17-14-7-8-15-11(10-14)2-1-9-18-15/h7-8,10,12-13,17H,1-6,9,16H2 |
| InChIKey | DCGTYIGQRVASRU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |