C12H18N2OS — CID 115121169
1-amino-3-(3,4-dihydro-2H-thiochromen-6-ylamino)propan-2-ol (PubChem CID 115121169) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 1-amino-3-(3,4-dihydro-2H-thiochromen-6-ylamino)propan-2-ol.
| Compound Name | 1-amino-3-(3,4-dihydro-2H-thiochromen-6-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 115121169 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-amino-3-(3,4-dihydro-2H-thiochromen-6-ylamino)propan-2-ol |
| SMILES | NCC(O)CNc1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C12H18N2OS/c13-7-11(15)8-14-10-3-4-12-9(6-10)2-1-5-16-12/h3-4,6,11,14-15H,1-2,5,7-8,13H2 |
| InChIKey | MYVGISGLPCNIIO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |