C11H15NOS — CID 115258276
N-(methoxymethyl)-3,4-dihydro-2H-thiochromen-6-amine (PubChem CID 115258276) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is N-(methoxymethyl)-3,4-dihydro-2H-thiochromen-6-amine.
| Compound Name | N-(methoxymethyl)-3,4-dihydro-2H-thiochromen-6-amine |
|---|---|
| PubChem CID | 115258276 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | N-(methoxymethyl)-3,4-dihydro-2H-thiochromen-6-amine |
| SMILES | COCNc1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C11H15NOS/c1-13-8-12-10-4-5-11-9(7-10)3-2-6-14-11/h4-5,7,12H,2-3,6,8H2,1H3 |
| InChIKey | BPGKAGDXLXUAOW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|