C12H15NO2S — CID 115232712
methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate (PubChem CID 115232712) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate.
| Compound Name | methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate |
|---|---|
| PubChem CID | 115232712 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate |
| SMILES | COC(=O)CNc1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C12H15NO2S/c1-15-12(14)8-13-10-4-5-11-9(7-10)3-2-6-16-11/h4-5,7,13H,2-3,6,8H2,1H3 |
| InChIKey | RBQCPMATBGUOLB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |