methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate

C12H15NO2S — CID 115232712

IUPACmethyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate
SMILESCOC(=O)CNc1ccc2c(c1)CCCS2
InChIInChI=1S/C12H15NO2S/c1-15-12(14)8-13-10-4-5-11-9(7-10)3-2-6-16-11/h4-5,7,13H,2-3,6,8H2,1H3
InChIKeyRBQCPMATBGUOLB-UHFFFAOYSA-N
MW237.32 g/mol
LogP2.31
Rot. Bonds3

About methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate

methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate (PubChem CID 115232712) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate.

Molecular Properties

Compound Namemethyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate
PubChem CID115232712
Molecular FormulaC12H15NO2S
Molecular Weight237.32 g/mol
Exact Mass237.08
IUPAC Namemethyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate
SMILESCOC(=O)CNc1ccc2c(c1)CCCS2
InChIInChI=1S/C12H15NO2S/c1-15-12(14)8-13-10-4-5-11-9(7-10)3-2-6-16-11/h4-5,7,13H,2-3,6,8H2,1H3
InChIKeyRBQCPMATBGUOLB-UHFFFAOYSA-N
XLogP2.31
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.32
LogP ≤ 52.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate?
The IUPAC name of methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate (CID 115232712) is methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate.
What is the SMILES notation for methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate?
The canonical SMILES for methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate is COC(=O)CNc1ccc2c(c1)CCCS2.
What is the InChIKey of methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate?
The InChIKey is RBQCPMATBGUOLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2S/c1-15-12(14)8-13-10-4-5-11-9(7-10)3-2-6-16-11/h4-5,7,13H,2-3,6,8H2,1H3.
What are the key properties of methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate?
methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate has a molecular weight of 237.32 g/mol, XLogP of 2.31, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,4-dihydro-2H-thiochromen-6-ylamino)acetate is sourced from PubChem (CID 115232712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).