C12H18N2S — CID 115197135
N'-(3,4-dihydro-2H-thiochromen-6-yl)propane-1,3-diamine (PubChem CID 115197135) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is N'-(3,4-dihydro-2H-thiochromen-6-yl)propane-1,3-diamine.
| Compound Name | N'-(3,4-dihydro-2H-thiochromen-6-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 115197135 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | N'-(3,4-dihydro-2H-thiochromen-6-yl)propane-1,3-diamine |
| SMILES | NCCCNc1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C12H18N2S/c13-6-2-7-14-11-4-5-12-10(9-11)3-1-8-15-12/h4-5,9,14H,1-3,6-8,13H2 |
| InChIKey | KJKPURRTBVNZGX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|