C21H31N7O — CID 170625392
3-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]-N-methylidene-3,8-diazabicyclo[3.2.1]octane-8-carboximidamide;ethane;methane (PubChem CID 170625392) has the molecular formula C21H31N7O and a molecular weight of 397.53 g/mol. Its IUPAC name is 3-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]-N-methylidene-3,8-diazabicyclo[3.2.1]octane-8-carboximidamide;ethane;methane.
| Compound Name | 3-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]-N-methylidene-3,8-diazabicyclo[3.2.1]octane-8-carboximidamide;ethane;methane |
|---|---|
| PubChem CID | 170625392 |
| Molecular Formula | C21H31N7O |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 3-[3-amino-6-(2-hydroxyphenyl)pyridazin-4-yl]-N-methylidene-3,8-diazabicyclo[3.2.1]octane-8-carboximidamide;ethane;methane |
| SMILES | C.CC.[H]/N=C(\N=C)N1C2CCC1CN(c1cc(-c3ccccc3O)nnc1N)C2 |
| InChI | InChI=1S/C18H21N7O.C2H6.CH4/c1-21-18(20)25-11-6-7-12(25)10-24(9-11)15-8-14(22-23-17(15)19)13-4-2-3-5-16(13)26;1-2;/h2-5,8,11-12,20,26H,1,6-7,9-10H2,(H2,19,23);1-2H3;1H4/b20-18+;; |
| InChIKey | SLAFROVNDFLGFP-VIPPSAFOSA-N |
| XLogP | 3.38 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|