C29H62N2O4 — CID 170630599
ethane;hexadecanamide;N-(1-hydroxypropan-2-yl)-5-oxohexanamide (PubChem CID 170630599) has the molecular formula C29H62N2O4 and a molecular weight of 502.83 g/mol. Its IUPAC name is ethane;hexadecanamide;N-(1-hydroxypropan-2-yl)-5-oxohexanamide.
| Compound Name | ethane;hexadecanamide;N-(1-hydroxypropan-2-yl)-5-oxohexanamide |
|---|---|
| PubChem CID | 170630599 |
| Molecular Formula | C29H62N2O4 |
| Molecular Weight | 502.83 g/mol |
| Exact Mass | 502.47 |
| IUPAC Name | ethane;hexadecanamide;N-(1-hydroxypropan-2-yl)-5-oxohexanamide |
| SMILES | CC.CC.CC(=O)CCCC(=O)NC(C)CO.CCCCCCCCCCCCCCCC(N)=O |
| InChI | InChI=1S/C16H33NO.C9H17NO3.2C2H6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-7(6-11)10-9(13)5-3-4-8(2)12;2*1-2/h2-15H2,1H3,(H2,17,18);7,11H,3-6H2,1-2H3,(H,10,13);2*1-2H3 |
| InChIKey | IOGVWSGCJVTZQE-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.83 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|