C8H11F6NO2 — CID 170638944
2,3,3,4,4,4-hexafluoro-N-(2-hydroxyethyl)-N,2-dimethylbutanamide (PubChem CID 170638944) has the molecular formula C8H11F6NO2 and a molecular weight of 267.17 g/mol. Its IUPAC name is 2,3,3,4,4,4-hexafluoro-N-(2-hydroxyethyl)-N,2-dimethylbutanamide.
| Compound Name | 2,3,3,4,4,4-hexafluoro-N-(2-hydroxyethyl)-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 170638944 |
| Molecular Formula | C8H11F6NO2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 2,3,3,4,4,4-hexafluoro-N-(2-hydroxyethyl)-N,2-dimethylbutanamide |
| SMILES | CN(CCO)C(=O)C(C)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H11F6NO2/c1-6(9,5(17)15(2)3-4-16)7(10,11)8(12,13)14/h16H,3-4H2,1-2H3 |
| InChIKey | WANKGDNNGKXVRE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|