C19H22N4O5S — CID 170640148
[4-[4-(2,4-dioxo-1,3-diazinan-1-yl)isoquinolin-8-yl]piperidin-3-yl]methanesulfonic acid (PubChem CID 170640148) has the molecular formula C19H22N4O5S and a molecular weight of 418.48 g/mol. Its IUPAC name is [4-[4-(2,4-dioxo-1,3-diazinan-1-yl)isoquinolin-8-yl]piperidin-3-yl]methanesulfonic acid.
| Compound Name | [4-[4-(2,4-dioxo-1,3-diazinan-1-yl)isoquinolin-8-yl]piperidin-3-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 170640148 |
| Molecular Formula | C19H22N4O5S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [4-[4-(2,4-dioxo-1,3-diazinan-1-yl)isoquinolin-8-yl]piperidin-3-yl]methanesulfonic acid |
| SMILES | O=C1CCN(c2cncc3c(C4CCNCC4CS(=O)(=O)O)cccc23)C(=O)N1 |
| InChI | InChI=1S/C19H22N4O5S/c24-18-5-7-23(19(25)22-18)17-10-21-9-16-14(2-1-3-15(16)17)13-4-6-20-8-12(13)11-29(26,27)28/h1-3,9-10,12-13,20H,4-8,11H2,(H,22,24,25)(H,26,27,28) |
| InChIKey | RHVRCFNNOWHZSO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|