C22H38O4S — CID 170645570
1,3-dimethoxy-5-[[3-(3-methoxy-3-methylpentoxy)-3-methylpentyl]sulfanylmethyl]benzene (PubChem CID 170645570) has the molecular formula C22H38O4S and a molecular weight of 398.61 g/mol. Its IUPAC name is 1,3-dimethoxy-5-[[3-(3-methoxy-3-methylpentoxy)-3-methylpentyl]sulfanylmethyl]benzene.
| Compound Name | 1,3-dimethoxy-5-[[3-(3-methoxy-3-methylpentoxy)-3-methylpentyl]sulfanylmethyl]benzene |
|---|---|
| PubChem CID | 170645570 |
| Molecular Formula | C22H38O4S |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 1,3-dimethoxy-5-[[3-(3-methoxy-3-methylpentoxy)-3-methylpentyl]sulfanylmethyl]benzene |
| SMILES | CCC(C)(CCOC(C)(CC)CCSCc1cc(OC)cc(OC)c1)OC |
| InChI | InChI=1S/C22H38O4S/c1-8-21(3,25-7)10-12-26-22(4,9-2)11-13-27-17-18-14-19(23-5)16-20(15-18)24-6/h14-16H,8-13,17H2,1-7H3 |
| InChIKey | JGUBHWYDFSWMBE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|