About CID 170645730
CID 170645730 (PubChem CID 170645730) has the molecular formula C26H18B2N2O2
and a molecular weight of 412.07 g/mol.
Molecular Properties
| Compound Name | CID 170645730 |
| PubChem CID | 170645730 |
| Molecular Formula | C26H18B2N2O2 |
| Molecular Weight | 412.07 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | — |
| SMILES | [B]C(=O)c1c(-c2ccccc2)[nH]c2ccccc12.[B]C(=O)c1c(C=C)[nH]c2ccccc12 |
| InChI | InChI=1S/C15H10BNO.C11H8BNO/c16-15(18)13-11-8-4-5-9-12(11)17-14(13)10-6-2-1-3-7-10;1-2-8-10(11(12)14)7-5-3-4-6-9(7)13-8/h1-9,17H;2-6,13H,1H2 |
| InChIKey | CRSBVKGSZOIQMO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.07 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 170645730 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170645730?
The IUPAC name of CID 170645730 (CID 170645730) is not available.
What is the SMILES notation for CID 170645730?
The canonical SMILES for CID 170645730 is [B]C(=O)c1c(-c2ccccc2)[nH]c2ccccc12.[B]C(=O)c1c(C=C)[nH]c2ccccc12.
What is the InChIKey of CID 170645730?
The InChIKey is CRSBVKGSZOIQMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10BNO.C11H8BNO/c16-15(18)13-11-8-4-5-9-12(11)17-14(13)10-6-2-1-3-7-10;1-2-8-10(11(12)14)7-5-3-4-6-9(7)13-8/h1-9,17H;2-6,13H,1H2.
What are the key properties of CID 170645730?
CID 170645730 has a molecular weight of 412.07 g/mol, XLogP of 5.26, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170645730 is sourced from PubChem (CID 170645730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).