C11H8Cl2O2 — CID 170647412
2-[(2,4-dichlorophenyl)methoxy]furan (PubChem CID 170647412) has the molecular formula C11H8Cl2O2 and a molecular weight of 243.09 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methoxy]furan.
| Compound Name | 2-[(2,4-dichlorophenyl)methoxy]furan |
|---|---|
| PubChem CID | 170647412 |
| Molecular Formula | C11H8Cl2O2 |
| Molecular Weight | 243.09 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methoxy]furan |
| SMILES | Clc1ccc(COc2ccco2)c(Cl)c1 |
| InChI | InChI=1S/C11H8Cl2O2/c12-9-4-3-8(10(13)6-9)7-15-11-2-1-5-14-11/h1-6H,7H2 |
| InChIKey | UUUFZDUYDZVVNA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.09 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |