C25H33F2N5O — CID 170650615
2-(2,4-difluorophenyl)-1-[4-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 170650615) has the molecular formula C25H33F2N5O and a molecular weight of 457.57 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-[4-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-[4-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 170650615 |
| Molecular Formula | C25H33F2N5O |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-[4-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]piperazin-1-yl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | CC1(C)[C@H]2CC=C(CN3CCN(CC(O)(Cn4cncn4)c4ccc(F)cc4F)CC3)[C@@H]1C2 |
| InChI | InChI=1S/C25H33F2N5O/c1-24(2)19-4-3-18(22(24)11-19)13-30-7-9-31(10-8-30)14-25(33,15-32-17-28-16-29-32)21-6-5-20(26)12-23(21)27/h3,5-6,12,16-17,19,22,33H,4,7-11,13-15H2,1-2H3/t19-,22-,25?/m0/s1 |
| InChIKey | CIROJBZUPLKJGH-HKJCUSPOSA-N |
| XLogP | 3.05 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|