C11H21NOSi — CID 170651628
(1-isocyano-3,3-dimethylcyclopentyl)oxy-trimethylsilane (PubChem CID 170651628) has the molecular formula C11H21NOSi and a molecular weight of 211.38 g/mol. Its IUPAC name is (1-isocyano-3,3-dimethylcyclopentyl)oxy-trimethylsilane.
| Compound Name | (1-isocyano-3,3-dimethylcyclopentyl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 170651628 |
| Molecular Formula | C11H21NOSi |
| Molecular Weight | 211.38 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (1-isocyano-3,3-dimethylcyclopentyl)oxy-trimethylsilane |
| SMILES | [C-]#[N+]C1(O[Si](C)(C)C)CCC(C)(C)C1 |
| InChI | InChI=1S/C11H21NOSi/c1-10(2)7-8-11(9-10,12-3)13-14(4,5)6/h7-9H2,1-2,4-6H3 |
| InChIKey | PESBENHAUOGAJH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|