C20H36O2 — CID 172736689
1,2-dicyclopentyloxy-1,2,4,4-tetramethylcyclohexane (PubChem CID 172736689) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is 1,2-dicyclopentyloxy-1,2,4,4-tetramethylcyclohexane.
| Compound Name | 1,2-dicyclopentyloxy-1,2,4,4-tetramethylcyclohexane |
|---|---|
| PubChem CID | 172736689 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | 1,2-dicyclopentyloxy-1,2,4,4-tetramethylcyclohexane |
| SMILES | CC1(C)CCC(C)(OC2CCCC2)C(C)(OC2CCCC2)C1 |
| InChI | InChI=1S/C20H36O2/c1-18(2)13-14-19(3,21-16-9-5-6-10-16)20(4,15-18)22-17-11-7-8-12-17/h16-17H,5-15H2,1-4H3 |
| InChIKey | LEOXKRYNCLQJJN-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |