C36H25Cl2NOS — CID 170654119
N-[2,3-dichloro-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2,3-dimethyl-N-(5-phenyl-1-benzothiophen-3-yl)-1-benzofuran-7-amine (PubChem CID 170654119) has the molecular formula C36H25Cl2NOS and a molecular weight of 595.61 g/mol. Its IUPAC name is N-[2,3-dichloro-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2,3-dimethyl-N-(5-phenyl-1-benzothiophen-3-yl)-1-benzofuran-7-amine.
| Compound Name | N-[2,3-dichloro-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2,3-dimethyl-N-(5-phenyl-1-benzothiophen-3-yl)-1-benzofuran-7-amine |
|---|---|
| PubChem CID | 170654119 |
| Molecular Formula | C36H25Cl2NOS |
| Molecular Weight | 595.61 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | N-[2,3-dichloro-5-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-2,3-dimethyl-N-(5-phenyl-1-benzothiophen-3-yl)-1-benzofuran-7-amine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(Cl)c(Cl)c(N(c3csc4ccc(-c5ccccc5)cc34)c3cccc4c(C)c(C)oc34)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C36H25Cl2NOS/c1-22-23(2)40-36-28(22)14-9-15-31(36)39(32-20-27(19-30(37)35(32)38)25-12-7-4-8-13-25)33-21-41-34-17-16-26(18-29(33)34)24-10-5-3-6-11-24/h3-21H,1-2H3/i4D,7D,8D,12D,13D |
| InChIKey | KGKBNSFZUSMQBO-KSJLTHBUSA-N |
| XLogP | 12.37 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.61 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |