C62H57N5OPt-2 — CID 170654705
CID 170654705 (PubChem CID 170654705) has the molecular formula C62H57N5OPt-2 and a molecular weight of 1083.25 g/mol.
| Compound Name | CID 170654705 |
|---|---|
| PubChem CID | 170654705 |
| Molecular Formula | C62H57N5OPt-2 |
| Molecular Weight | 1083.25 g/mol |
| Exact Mass | 1082.42 |
| IUPAC Name | — |
| SMILES | Cc1cccc(-c2ccccc2)c1-c1n[n+](-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)[c-]n1-c1[c-]c(Oc2[c-]c3c(c(-c4ccccc4)c2)c2ccccc2n3-c2cc(C(C)(C)C)ccn2)ccc1.[Pt] |
| InChI | InChI=1S/C62H57N5O.Pt/c1-41-21-19-29-51(42-22-13-11-14-23-42)57(41)59-64-66(48-34-45(61(5,6)7)33-46(35-48)62(8,9)10)40-65(59)47-26-20-27-49(37-47)68-50-38-53(43-24-15-12-16-25-43)58-52-28-17-18-30-54(52)67(55(58)39-50)56-36-44(31-32-63-56)60(2,3)4;/h11-36,38H,1-10H3;/q-2; |
| InChIKey | GJTSEZHOLJEGRZ-UHFFFAOYSA-N |
| XLogP | 15.03 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1083.25 |
| LogP ≤ 5 | 15.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|