C60H61N5OPt-2 — CID 170654850
CID 170654850 (PubChem CID 170654850) has the molecular formula C60H61N5OPt-2 and a molecular weight of 1063.26 g/mol.
| Compound Name | CID 170654850 |
|---|---|
| PubChem CID | 170654850 |
| Molecular Formula | C60H61N5OPt-2 |
| Molecular Weight | 1063.26 g/mol |
| Exact Mass | 1062.45 |
| IUPAC Name | — |
| SMILES | Cc1cccc(-c2ccccc2)c1-c1n[n+](-c2cc(C(C)(C)C)cc(C(C)(C)C)c2)[c-]n1-c1[c-]c(Oc2[c-]c3c(cc2)c2cc(C(C)(C)C)ccc2n3-c2cc(C(C)(C)C)ccn2)ccc1.[Pt] |
| InChI | InChI=1S/C60H61N5O.Pt/c1-39-19-17-24-49(40-20-15-14-16-21-40)55(39)56-62-64(46-32-43(59(8,9)10)31-44(33-46)60(11,12)13)38-63(56)45-22-18-23-47(36-45)66-48-26-27-50-51-34-41(57(2,3)4)25-28-52(51)65(53(50)37-48)54-35-42(29-30-61-54)58(5,6)7;/h14-35H,1-13H3;/q-2; |
| InChIKey | QQCXVUNTXOPLSA-UHFFFAOYSA-N |
| XLogP | 14.66 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1063.26 |
| LogP ≤ 5 | 14.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|