C65H63N5OPt-2 — CID 170654733
CID 170654733 (PubChem CID 170654733) has the molecular formula C65H63N5OPt-2 and a molecular weight of 1135.39 g/mol.
| Compound Name | CID 170654733 |
|---|---|
| PubChem CID | 170654733 |
| Molecular Formula | C65H63N5OPt-2 |
| Molecular Weight | 1135.39 g/mol |
| Exact Mass | 1134.53 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])c2-c2n[n+](-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)[c-]n2-c2[c-]c(Oc3[c-]c4c(cc3)c3ccccc3n4-c3cc(C(C)(C)C)ccn3)cc(C(C)(C)C)c2)c([2H])c1[2H].[Pt] |
| InChI | InChI=1S/C65H63N5O.Pt/c1-62(2,3)45-32-33-66-59(39-45)70-57-29-20-19-26-55(57)56-31-30-51(41-58(56)70)71-52-38-48(65(10,11)12)35-49(40-52)68-42-69(50-36-46(63(4,5)6)34-47(37-50)64(7,8)9)67-61(68)60-53(43-22-15-13-16-23-43)27-21-28-54(60)44-24-17-14-18-25-44;/h13-39H,1-12H3;/q-2;/i13D,14D,15D,16D,17D,18D,22D,23D,24D,25D; |
| InChIKey | CBUNJOLDORYWJE-QMKZPJEISA-N |
| XLogP | 16.02 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1135.39 |
| LogP ≤ 5 | 16.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|